C12H21N7O2 — CID 136821405
4-(tert-butylamino)-N'-hydroxy-6-morpholin-4-yl-1,3,5-triazine-2-carboximidamide (PubChem CID 136821405) has the molecular formula C12H21N7O2 and a molecular weight of 295.35 g/mol. Its IUPAC name is 4-(tert-butylamino)-N'-hydroxy-6-morpholin-4-yl-1,3,5-triazine-2-carboximidamide.
| Compound Name | 4-(tert-butylamino)-N'-hydroxy-6-morpholin-4-yl-1,3,5-triazine-2-carboximidamide |
|---|---|
| PubChem CID | 136821405 |
| Molecular Formula | C12H21N7O2 |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 4-(tert-butylamino)-N'-hydroxy-6-morpholin-4-yl-1,3,5-triazine-2-carboximidamide |
| SMILES | CC(C)(C)Nc1nc(/C(N)=N/O)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C12H21N7O2/c1-12(2,3)17-10-14-9(8(13)18-20)15-11(16-10)19-4-6-21-7-5-19/h20H,4-7H2,1-3H3,(H2,13,18)(H,14,15,16,17) |
| InChIKey | WNWANIDSFKBEIV-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 121.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|