C12H19N7O3 — CID 135517571
N'-hydroxy-4,6-dimorpholin-4-yl-1,3,5-triazine-2-carboximidamide (PubChem CID 135517571) has the molecular formula C12H19N7O3 and a molecular weight of 309.33 g/mol. Its IUPAC name is N'-hydroxy-4,6-dimorpholin-4-yl-1,3,5-triazine-2-carboximidamide.
| Compound Name | N'-hydroxy-4,6-dimorpholin-4-yl-1,3,5-triazine-2-carboximidamide |
|---|---|
| PubChem CID | 135517571 |
| Molecular Formula | C12H19N7O3 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | N'-hydroxy-4,6-dimorpholin-4-yl-1,3,5-triazine-2-carboximidamide |
| SMILES | N/C(=N/O)c1nc(N2CCOCC2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C12H19N7O3/c13-9(17-20)10-14-11(18-1-5-21-6-2-18)16-12(15-10)19-3-7-22-8-4-19/h20H,1-8H2,(H2,13,17) |
| InChIKey | CUVYIRKSQLNWRG-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 122.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|