C11H20N4O — CID 159951324
4-(4,6-dimethyl-1,3,5-triazin-2-yl)morpholine;ethane (PubChem CID 159951324) has the molecular formula C11H20N4O and a molecular weight of 224.31 g/mol. Its IUPAC name is 4-(4,6-dimethyl-1,3,5-triazin-2-yl)morpholine;ethane.
| Compound Name | 4-(4,6-dimethyl-1,3,5-triazin-2-yl)morpholine;ethane |
|---|---|
| PubChem CID | 159951324 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 4-(4,6-dimethyl-1,3,5-triazin-2-yl)morpholine;ethane |
| SMILES | CC.Cc1nc(C)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C9H14N4O.C2H6/c1-7-10-8(2)12-9(11-7)13-3-5-14-6-4-13;1-2/h3-6H2,1-2H3;1-2H3 |
| InChIKey | OCDNWQUASJJHCK-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |