C11H18N4O — CID 62192217
N,5,6-trimethyl-2-morpholin-4-ylpyrimidin-4-amine (PubChem CID 62192217) has the molecular formula C11H18N4O and a molecular weight of 222.29 g/mol. Its IUPAC name is N,5,6-trimethyl-2-morpholin-4-ylpyrimidin-4-amine.
| Compound Name | N,5,6-trimethyl-2-morpholin-4-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 62192217 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | N,5,6-trimethyl-2-morpholin-4-ylpyrimidin-4-amine |
| SMILES | CNc1nc(N2CCOCC2)nc(C)c1C |
| InChI | InChI=1S/C11H18N4O/c1-8-9(2)13-11(14-10(8)12-3)15-4-6-16-7-5-15/h4-7H2,1-3H3,(H,12,13,14) |
| InChIKey | OTSYQWJLFOOZAX-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |