C8H14N6O — CID 80770087
2-N-methyl-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine (PubChem CID 80770087) has the molecular formula C8H14N6O and a molecular weight of 210.24 g/mol. Its IUPAC name is 2-N-methyl-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-methyl-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80770087 |
| Molecular Formula | C8H14N6O |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 2-N-methyl-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine |
| SMILES | CNc1nc(N)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C8H14N6O/c1-10-7-11-6(9)12-8(13-7)14-2-4-15-5-3-14/h2-5H2,1H3,(H3,9,10,11,12,13) |
| InChIKey | IXPULUNLCODHPL-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |