C13H21IN4O — CID 66299019
6-tert-butyl-5-iodo-N-methyl-2-morpholin-4-ylpyrimidin-4-amine (PubChem CID 66299019) has the molecular formula C13H21IN4O and a molecular weight of 376.24 g/mol. Its IUPAC name is 6-tert-butyl-5-iodo-N-methyl-2-morpholin-4-ylpyrimidin-4-amine.
| Compound Name | 6-tert-butyl-5-iodo-N-methyl-2-morpholin-4-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66299019 |
| Molecular Formula | C13H21IN4O |
| Molecular Weight | 376.24 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 6-tert-butyl-5-iodo-N-methyl-2-morpholin-4-ylpyrimidin-4-amine |
| SMILES | CNc1nc(N2CCOCC2)nc(C(C)(C)C)c1I |
| InChI | InChI=1S/C13H21IN4O/c1-13(2,3)10-9(14)11(15-4)17-12(16-10)18-5-7-19-8-6-18/h5-8H2,1-4H3,(H,15,16,17) |
| InChIKey | LKDNFFQLNXZMRO-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.24 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|