C9H11Cl2N3O — CID 134511412
4-(5,6-dichloro-2-methylpyrimidin-4-yl)morpholine (PubChem CID 134511412) has the molecular formula C9H11Cl2N3O and a molecular weight of 248.11 g/mol. Its IUPAC name is 4-(5,6-dichloro-2-methylpyrimidin-4-yl)morpholine.
| Compound Name | 4-(5,6-dichloro-2-methylpyrimidin-4-yl)morpholine |
|---|---|
| PubChem CID | 134511412 |
| Molecular Formula | C9H11Cl2N3O |
| Molecular Weight | 248.11 g/mol |
| Exact Mass | 247.03 |
| IUPAC Name | 4-(5,6-dichloro-2-methylpyrimidin-4-yl)morpholine |
| SMILES | Cc1nc(Cl)c(Cl)c(N2CCOCC2)n1 |
| InChI | InChI=1S/C9H11Cl2N3O/c1-6-12-8(11)7(10)9(13-6)14-2-4-15-5-3-14/h2-5H2,1H3 |
| InChIKey | RYOGNPVVHXQUOB-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.11 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |