C14H22N4O2 — CID 144820201
2-methyl-4-morpholin-4-yl-5,6,7,9,10,11-hexahydropyrimido[4,5-e][1,4]oxazonine (PubChem CID 144820201) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is 2-methyl-4-morpholin-4-yl-5,6,7,9,10,11-hexahydropyrimido[4,5-e][1,4]oxazonine.
| Compound Name | 2-methyl-4-morpholin-4-yl-5,6,7,9,10,11-hexahydropyrimido[4,5-e][1,4]oxazonine |
|---|---|
| PubChem CID | 144820201 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 2-methyl-4-morpholin-4-yl-5,6,7,9,10,11-hexahydropyrimido[4,5-e][1,4]oxazonine |
| SMILES | Cc1nc2c(c(N3CCOCC3)n1)CCCOCCN2 |
| InChI | InChI=1S/C14H22N4O2/c1-11-16-13-12(3-2-7-19-8-4-15-13)14(17-11)18-5-9-20-10-6-18/h2-10H2,1H3,(H,15,16,17) |
| InChIKey | RQFWJIBRPKDOTO-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |