C21H28N6O3 — CID 137467722
1-methyl-3-[4-(4-morpholin-4-yl-5,6,7,9,10,11-hexahydropyrimido[4,5-e][1,4]oxazonin-2-yl)phenyl]urea (PubChem CID 137467722) has the molecular formula C21H28N6O3 and a molecular weight of 412.49 g/mol. Its IUPAC name is 1-methyl-3-[4-(4-morpholin-4-yl-5,6,7,9,10,11-hexahydropyrimido[4,5-e][1,4]oxazonin-2-yl)phenyl]urea.
| Compound Name | 1-methyl-3-[4-(4-morpholin-4-yl-5,6,7,9,10,11-hexahydropyrimido[4,5-e][1,4]oxazonin-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 137467722 |
| Molecular Formula | C21H28N6O3 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | 1-methyl-3-[4-(4-morpholin-4-yl-5,6,7,9,10,11-hexahydropyrimido[4,5-e][1,4]oxazonin-2-yl)phenyl]urea |
| SMILES | CNC(=O)Nc1ccc(-c2nc3c(c(N4CCOCC4)n2)CCCOCCN3)cc1 |
| InChI | InChI=1S/C21H28N6O3/c1-22-21(28)24-16-6-4-15(5-7-16)18-25-19-17(3-2-11-29-12-8-23-19)20(26-18)27-9-13-30-14-10-27/h4-7H,2-3,8-14H2,1H3,(H2,22,24,28)(H,23,25,26) |
| InChIKey | UTYUDXPZUOSJKJ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 100.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |