C23H29N7O3 — CID 67478381
1-ethyl-3-[4-[(1S)-6-morpholin-4-yl-11-oxo-3,5,10,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-4-yl]phenyl]urea (PubChem CID 67478381) has the molecular formula C23H29N7O3 and a molecular weight of 451.53 g/mol. Its IUPAC name is 1-ethyl-3-[4-[(1S)-6-morpholin-4-yl-11-oxo-3,5,10,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-4-yl]phenyl]urea.
| Compound Name | 1-ethyl-3-[4-[(1S)-6-morpholin-4-yl-11-oxo-3,5,10,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-4-yl]phenyl]urea |
|---|---|
| PubChem CID | 67478381 |
| Molecular Formula | C23H29N7O3 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | 1-ethyl-3-[4-[(1S)-6-morpholin-4-yl-11-oxo-3,5,10,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-4-yl]phenyl]urea |
| SMILES | CCNC(=O)Nc1ccc(-c2nc3c(c(N4CCOCC4)n2)CCN2C(=O)NCC[C@@H]32)cc1 |
| InChI | InChI=1S/C23H29N7O3/c1-2-24-22(31)26-16-5-3-15(4-6-16)20-27-19-17(21(28-20)29-11-13-33-14-12-29)8-10-30-18(19)7-9-25-23(30)32/h3-6,18H,2,7-14H2,1H3,(H,25,32)(H2,24,26,31)/t18-/m0/s1 |
| InChIKey | JSCRWPXZZBVCLR-SFHVURJKSA-N |
| XLogP | 2.13 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |