C20H26ClN5O2 — CID 89181960
1-tert-butyl-3-[4-(4-chloro-5-methyl-6-morpholin-4-ylpyrimidin-2-yl)phenyl]urea (PubChem CID 89181960) has the molecular formula C20H26ClN5O2 and a molecular weight of 403.91 g/mol. Its IUPAC name is 1-tert-butyl-3-[4-(4-chloro-5-methyl-6-morpholin-4-ylpyrimidin-2-yl)phenyl]urea.
| Compound Name | 1-tert-butyl-3-[4-(4-chloro-5-methyl-6-morpholin-4-ylpyrimidin-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 89181960 |
| Molecular Formula | C20H26ClN5O2 |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 1-tert-butyl-3-[4-(4-chloro-5-methyl-6-morpholin-4-ylpyrimidin-2-yl)phenyl]urea |
| SMILES | Cc1c(Cl)nc(-c2ccc(NC(=O)NC(C)(C)C)cc2)nc1N1CCOCC1 |
| InChI | InChI=1S/C20H26ClN5O2/c1-13-16(21)23-17(24-18(13)26-9-11-28-12-10-26)14-5-7-15(8-6-14)22-19(27)25-20(2,3)4/h5-8H,9-12H2,1-4H3,(H2,22,25,27) |
| InChIKey | IHWGFVUQDGMWSJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |