C21H21ClN6O2 — CID 89181939
1-[5-(4-chloro-5-methyl-6-morpholin-4-ylpyrimidin-2-yl)-2-pyridinyl]-3-phenylurea (PubChem CID 89181939) has the molecular formula C21H21ClN6O2 and a molecular weight of 424.89 g/mol. Its IUPAC name is 1-[5-(4-chloro-5-methyl-6-morpholin-4-ylpyrimidin-2-yl)-2-pyridinyl]-3-phenylurea.
| Compound Name | 1-[5-(4-chloro-5-methyl-6-morpholin-4-ylpyrimidin-2-yl)-2-pyridinyl]-3-phenylurea |
|---|---|
| PubChem CID | 89181939 |
| Molecular Formula | C21H21ClN6O2 |
| Molecular Weight | 424.89 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 1-[5-(4-chloro-5-methyl-6-morpholin-4-ylpyrimidin-2-yl)-2-pyridinyl]-3-phenylurea |
| SMILES | Cc1c(Cl)nc(-c2ccc(NC(=O)Nc3ccccc3)nc2)nc1N1CCOCC1 |
| InChI | InChI=1S/C21H21ClN6O2/c1-14-18(22)26-19(27-20(14)28-9-11-30-12-10-28)15-7-8-17(23-13-15)25-21(29)24-16-5-3-2-4-6-16/h2-8,13H,9-12H2,1H3,(H2,23,24,25,29) |
| InChIKey | BNLYWQAZIRISHY-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.89 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |