C18H21Cl2N5O2 — CID 89181870
1-(2-chloroethyl)-3-[4-(4-chloro-5-methyl-6-morpholin-4-ylpyrimidin-2-yl)phenyl]urea (PubChem CID 89181870) has the molecular formula C18H21Cl2N5O2 and a molecular weight of 410.31 g/mol. Its IUPAC name is 1-(2-chloroethyl)-3-[4-(4-chloro-5-methyl-6-morpholin-4-ylpyrimidin-2-yl)phenyl]urea.
| Compound Name | 1-(2-chloroethyl)-3-[4-(4-chloro-5-methyl-6-morpholin-4-ylpyrimidin-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 89181870 |
| Molecular Formula | C18H21Cl2N5O2 |
| Molecular Weight | 410.31 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | 1-(2-chloroethyl)-3-[4-(4-chloro-5-methyl-6-morpholin-4-ylpyrimidin-2-yl)phenyl]urea |
| SMILES | Cc1c(Cl)nc(-c2ccc(NC(=O)NCCCl)cc2)nc1N1CCOCC1 |
| InChI | InChI=1S/C18H21Cl2N5O2/c1-12-15(20)23-16(24-17(12)25-8-10-27-11-9-25)13-2-4-14(5-3-13)22-18(26)21-7-6-19/h2-5H,6-11H2,1H3,(H2,21,22,26) |
| InChIKey | UPUQTYBLDRDIFX-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.31 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|