C20H25N7O3 — CID 118000039
1-methyl-3-[5-[(9R)-6-morpholin-4-yl-11-oxa-1,3,5-triazatricyclo[7.4.0.02,7]trideca-2,4,6-trien-4-yl]-2-pyridinyl]urea (PubChem CID 118000039) has the molecular formula C20H25N7O3 and a molecular weight of 411.47 g/mol. Its IUPAC name is 1-methyl-3-[5-[(9R)-6-morpholin-4-yl-11-oxa-1,3,5-triazatricyclo[7.4.0.02,7]trideca-2,4,6-trien-4-yl]-2-pyridinyl]urea.
| Compound Name | 1-methyl-3-[5-[(9R)-6-morpholin-4-yl-11-oxa-1,3,5-triazatricyclo[7.4.0.02,7]trideca-2,4,6-trien-4-yl]-2-pyridinyl]urea |
|---|---|
| PubChem CID | 118000039 |
| Molecular Formula | C20H25N7O3 |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | 1-methyl-3-[5-[(9R)-6-morpholin-4-yl-11-oxa-1,3,5-triazatricyclo[7.4.0.02,7]trideca-2,4,6-trien-4-yl]-2-pyridinyl]urea |
| SMILES | CNC(=O)Nc1ccc(-c2nc(N3CCOCC3)c3c(n2)N2CCOC[C@H]2C3)cn1 |
| InChI | InChI=1S/C20H25N7O3/c1-21-20(28)23-16-3-2-13(11-22-16)17-24-18(26-4-7-29-8-5-26)15-10-14-12-30-9-6-27(14)19(15)25-17/h2-3,11,14H,4-10,12H2,1H3,(H2,21,22,23,28)/t14-/m1/s1 |
| InChIKey | OATATCIKVHPPTL-CQSZACIVSA-N |
| XLogP | 0.89 |
| TPSA | 104.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |