C34H42N8O4 — CID 123829937
1-[4-[4-(dimethylamino)piperidine-1-carbonyl]phenyl]-3-[4-(6-morpholin-4-yl-11-oxa-1,3,5-triazatricyclo[7.4.0.02,7]trideca-2,4,6-trien-4-yl)phenyl]urea (PubChem CID 123829937) has the molecular formula C34H42N8O4 and a molecular weight of 626.76 g/mol. Its IUPAC name is 1-[4-[4-(dimethylamino)piperidine-1-carbonyl]phenyl]-3-[4-(6-morpholin-4-yl-11-oxa-1,3,5-triazatricyclo[7.4.0.02,7]trideca-2,4,6-trien-4-yl)phenyl]urea.
| Compound Name | 1-[4-[4-(dimethylamino)piperidine-1-carbonyl]phenyl]-3-[4-(6-morpholin-4-yl-11-oxa-1,3,5-triazatricyclo[7.4.0.02,7]trideca-2,4,6-trien-4-yl)phenyl]urea |
|---|---|
| PubChem CID | 123829937 |
| Molecular Formula | C34H42N8O4 |
| Molecular Weight | 626.76 g/mol |
| Exact Mass | 626.33 |
| IUPAC Name | 1-[4-[4-(dimethylamino)piperidine-1-carbonyl]phenyl]-3-[4-(6-morpholin-4-yl-11-oxa-1,3,5-triazatricyclo[7.4.0.02,7]trideca-2,4,6-trien-4-yl)phenyl]urea |
| SMILES | CN(C)C1CCN(C(=O)c2ccc(NC(=O)Nc3ccc(-c4nc(N5CCOCC5)c5c(n4)N4CCOCC4C5)cc3)cc2)CC1 |
| InChI | InChI=1S/C34H42N8O4/c1-39(2)27-11-13-41(14-12-27)33(43)24-5-9-26(10-6-24)36-34(44)35-25-7-3-23(4-8-25)30-37-31(40-15-18-45-19-16-40)29-21-28-22-46-20-17-42(28)32(29)38-30/h3-10,27-28H,11-22H2,1-2H3,(H2,35,36,44) |
| InChIKey | RXQPTZNMBMTMIT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 115.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.76 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |