C22H27N7O3 — CID 146233694
N-[5-(6,7-dimethyl-4-morpholin-4-yl-6,7,9,10-tetrahydropurino[9,8-d][1,4]oxazepin-2-yl)-2-pyridinyl]acetamide (PubChem CID 146233694) has the molecular formula C22H27N7O3 and a molecular weight of 437.50 g/mol. Its IUPAC name is N-[5-(6,7-dimethyl-4-morpholin-4-yl-6,7,9,10-tetrahydropurino[9,8-d][1,4]oxazepin-2-yl)-2-pyridinyl]acetamide.
| Compound Name | N-[5-(6,7-dimethyl-4-morpholin-4-yl-6,7,9,10-tetrahydropurino[9,8-d][1,4]oxazepin-2-yl)-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 146233694 |
| Molecular Formula | C22H27N7O3 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | N-[5-(6,7-dimethyl-4-morpholin-4-yl-6,7,9,10-tetrahydropurino[9,8-d][1,4]oxazepin-2-yl)-2-pyridinyl]acetamide |
| SMILES | CC(=O)Nc1ccc(-c2nc(N3CCOCC3)c3nc4n(c3n2)CCOC(C)C4C)cn1 |
| InChI | InChI=1S/C22H27N7O3/c1-13-14(2)32-11-8-29-20(13)25-18-21(28-6-9-31-10-7-28)26-19(27-22(18)29)16-4-5-17(23-12-16)24-15(3)30/h4-5,12-14H,6-11H2,1-3H3,(H,23,24,30) |
| InChIKey | BJZSONDSTRWTIQ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 107.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |