C21H29N5O2S — CID 143633340
1-tert-butyl-3-[4-[4-(methylsulfanylmethyl)-6-morpholin-4-ylpyrimidin-2-yl]phenyl]urea (PubChem CID 143633340) has the molecular formula C21H29N5O2S and a molecular weight of 415.56 g/mol. Its IUPAC name is 1-tert-butyl-3-[4-[4-(methylsulfanylmethyl)-6-morpholin-4-ylpyrimidin-2-yl]phenyl]urea.
| Compound Name | 1-tert-butyl-3-[4-[4-(methylsulfanylmethyl)-6-morpholin-4-ylpyrimidin-2-yl]phenyl]urea |
|---|---|
| PubChem CID | 143633340 |
| Molecular Formula | C21H29N5O2S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 1-tert-butyl-3-[4-[4-(methylsulfanylmethyl)-6-morpholin-4-ylpyrimidin-2-yl]phenyl]urea |
| SMILES | CSCc1cc(N2CCOCC2)nc(-c2ccc(NC(=O)NC(C)(C)C)cc2)n1 |
| InChI | InChI=1S/C21H29N5O2S/c1-21(2,3)25-20(27)23-16-7-5-15(6-8-16)19-22-17(14-29-4)13-18(24-19)26-9-11-28-12-10-26/h5-8,13H,9-12,14H2,1-4H3,(H2,23,25,27) |
| InChIKey | NQTBKDMVTRRRFS-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |