C22H24N6O2S2 — CID 143633276
1-cyclopropyl-3-[4-[4-morpholin-4-yl-6-(1,3-thiazol-2-ylsulfanylmethyl)pyrimidin-2-yl]phenyl]urea (PubChem CID 143633276) has the molecular formula C22H24N6O2S2 and a molecular weight of 468.61 g/mol. Its IUPAC name is 1-cyclopropyl-3-[4-[4-morpholin-4-yl-6-(1,3-thiazol-2-ylsulfanylmethyl)pyrimidin-2-yl]phenyl]urea.
| Compound Name | 1-cyclopropyl-3-[4-[4-morpholin-4-yl-6-(1,3-thiazol-2-ylsulfanylmethyl)pyrimidin-2-yl]phenyl]urea |
|---|---|
| PubChem CID | 143633276 |
| Molecular Formula | C22H24N6O2S2 |
| Molecular Weight | 468.61 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | 1-cyclopropyl-3-[4-[4-morpholin-4-yl-6-(1,3-thiazol-2-ylsulfanylmethyl)pyrimidin-2-yl]phenyl]urea |
| SMILES | O=C(Nc1ccc(-c2nc(CSc3nccs3)cc(N3CCOCC3)n2)cc1)NC1CC1 |
| InChI | InChI=1S/C22H24N6O2S2/c29-21(26-17-5-6-17)25-16-3-1-15(2-4-16)20-24-18(14-32-22-23-7-12-31-22)13-19(27-20)28-8-10-30-11-9-28/h1-4,7,12-13,17H,5-6,8-11,14H2,(H2,25,26,29) |
| InChIKey | SAZYMDRPYRJNQI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.61 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|