C19H21N5O2S — CID 143742096
2-cyano-N-[4-[4-(methylsulfanylmethyl)-6-morpholin-4-ylpyrimidin-2-yl]phenyl]acetamide (PubChem CID 143742096) has the molecular formula C19H21N5O2S and a molecular weight of 383.48 g/mol. Its IUPAC name is 2-cyano-N-[4-[4-(methylsulfanylmethyl)-6-morpholin-4-ylpyrimidin-2-yl]phenyl]acetamide.
| Compound Name | 2-cyano-N-[4-[4-(methylsulfanylmethyl)-6-morpholin-4-ylpyrimidin-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 143742096 |
| Molecular Formula | C19H21N5O2S |
| Molecular Weight | 383.48 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 2-cyano-N-[4-[4-(methylsulfanylmethyl)-6-morpholin-4-ylpyrimidin-2-yl]phenyl]acetamide |
| SMILES | CSCc1cc(N2CCOCC2)nc(-c2ccc(NC(=O)CC#N)cc2)n1 |
| InChI | InChI=1S/C19H21N5O2S/c1-27-13-16-12-17(24-8-10-26-11-9-24)23-19(22-16)14-2-4-15(5-3-14)21-18(25)6-7-20/h2-5,12H,6,8-11,13H2,1H3,(H,21,25) |
| InChIKey | RBFRCAYNTCCPIH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.48 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |