C23H29N7O3S — CID 143633252
1-[4-[4-(2-hydroxyethylsulfanylmethyl)-6-morpholin-4-ylpyrimidin-2-yl]phenyl]-3-[(1-methylpyrazol-4-yl)methyl]urea (PubChem CID 143633252) has the molecular formula C23H29N7O3S and a molecular weight of 483.60 g/mol. Its IUPAC name is 1-[4-[4-(2-hydroxyethylsulfanylmethyl)-6-morpholin-4-ylpyrimidin-2-yl]phenyl]-3-[(1-methylpyrazol-4-yl)methyl]urea.
| Compound Name | 1-[4-[4-(2-hydroxyethylsulfanylmethyl)-6-morpholin-4-ylpyrimidin-2-yl]phenyl]-3-[(1-methylpyrazol-4-yl)methyl]urea |
|---|---|
| PubChem CID | 143633252 |
| Molecular Formula | C23H29N7O3S |
| Molecular Weight | 483.60 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | 1-[4-[4-(2-hydroxyethylsulfanylmethyl)-6-morpholin-4-ylpyrimidin-2-yl]phenyl]-3-[(1-methylpyrazol-4-yl)methyl]urea |
| SMILES | Cn1cc(CNC(=O)Nc2ccc(-c3nc(CSCCO)cc(N4CCOCC4)n3)cc2)cn1 |
| InChI | InChI=1S/C23H29N7O3S/c1-29-15-17(14-25-29)13-24-23(32)27-19-4-2-18(3-5-19)22-26-20(16-34-11-8-31)12-21(28-22)30-6-9-33-10-7-30/h2-5,12,14-15,31H,6-11,13,16H2,1H3,(H2,24,27,32) |
| InChIKey | BMQXVUKKGLTCSJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 117.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.60 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|