C22H33N6O2S+ — CID 143633229
[2-[4-[2-(dimethylamino)ethylcarbamoylamino]phenyl]-6-morpholin-4-ylpyrimidin-4-yl]methyl-ethylsulfanium (PubChem CID 143633229) has the molecular formula C22H33N6O2S+ and a molecular weight of 445.61 g/mol. Its IUPAC name is [2-[4-[2-(dimethylamino)ethylcarbamoylamino]phenyl]-6-morpholin-4-ylpyrimidin-4-yl]methyl-ethylsulfanium.
| Compound Name | [2-[4-[2-(dimethylamino)ethylcarbamoylamino]phenyl]-6-morpholin-4-ylpyrimidin-4-yl]methyl-ethylsulfanium |
|---|---|
| PubChem CID | 143633229 |
| Molecular Formula | C22H33N6O2S+ |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | [2-[4-[2-(dimethylamino)ethylcarbamoylamino]phenyl]-6-morpholin-4-ylpyrimidin-4-yl]methyl-ethylsulfanium |
| SMILES | CC[SH+]Cc1cc(N2CCOCC2)nc(-c2ccc(NC(=O)NCCN(C)C)cc2)n1 |
| InChI | InChI=1S/C22H32N6O2S/c1-4-31-16-19-15-20(28-11-13-30-14-12-28)26-21(24-19)17-5-7-18(8-6-17)25-22(29)23-9-10-27(2)3/h5-8,15H,4,9-14,16H2,1-3H3,(H2,23,25,29)/p+1 |
| InChIKey | VNYMYSKCUQRFJN-UHFFFAOYSA-O |
| XLogP | 2.00 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|