C21H30N5O2S+ — CID 143633058
[2-[4-(ethylcarbamoylamino)phenyl]-6-morpholin-4-ylpyrimidin-4-yl]methyl-propan-2-ylsulfanium (PubChem CID 143633058) has the molecular formula C21H30N5O2S+ and a molecular weight of 416.57 g/mol. Its IUPAC name is [2-[4-(ethylcarbamoylamino)phenyl]-6-morpholin-4-ylpyrimidin-4-yl]methyl-propan-2-ylsulfanium.
| Compound Name | [2-[4-(ethylcarbamoylamino)phenyl]-6-morpholin-4-ylpyrimidin-4-yl]methyl-propan-2-ylsulfanium |
|---|---|
| PubChem CID | 143633058 |
| Molecular Formula | C21H30N5O2S+ |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | [2-[4-(ethylcarbamoylamino)phenyl]-6-morpholin-4-ylpyrimidin-4-yl]methyl-propan-2-ylsulfanium |
| SMILES | CCNC(=O)Nc1ccc(-c2nc(C[SH+]C(C)C)cc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C21H29N5O2S/c1-4-22-21(27)24-17-7-5-16(6-8-17)20-23-18(14-29-15(2)3)13-19(25-20)26-9-11-28-12-10-26/h5-8,13,15H,4,9-12,14H2,1-3H3,(H2,22,24,27)/p+1 |
| InChIKey | KDVLLEJTMDQXJF-UHFFFAOYSA-O |
| XLogP | 2.84 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|