C23H27N7O4S — CID 88850973
1-[4-[4-[(3S)-3-methylmorpholin-4-yl]-6-(1-sulfonylethyl)pyrimidin-2-yl]phenyl]-3-[(1-methylpyrazol-4-yl)methyl]urea (PubChem CID 88850973) has the molecular formula C23H27N7O4S and a molecular weight of 497.58 g/mol. Its IUPAC name is 1-[4-[4-[(3S)-3-methylmorpholin-4-yl]-6-(1-sulfonylethyl)pyrimidin-2-yl]phenyl]-3-[(1-methylpyrazol-4-yl)methyl]urea.
| Compound Name | 1-[4-[4-[(3S)-3-methylmorpholin-4-yl]-6-(1-sulfonylethyl)pyrimidin-2-yl]phenyl]-3-[(1-methylpyrazol-4-yl)methyl]urea |
|---|---|
| PubChem CID | 88850973 |
| Molecular Formula | C23H27N7O4S |
| Molecular Weight | 497.58 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | 1-[4-[4-[(3S)-3-methylmorpholin-4-yl]-6-(1-sulfonylethyl)pyrimidin-2-yl]phenyl]-3-[(1-methylpyrazol-4-yl)methyl]urea |
| SMILES | CC(c1cc(N2CCOC[C@@H]2C)nc(-c2ccc(NC(=O)NCc3cnn(C)c3)cc2)n1)=S(=O)=O |
| InChI | InChI=1S/C23H27N7O4S/c1-15-14-34-9-8-30(15)21-10-20(16(2)35(32)33)27-22(28-21)18-4-6-19(7-5-18)26-23(31)24-11-17-12-25-29(3)13-17/h4-7,10,12-13,15H,8-9,11,14H2,1-3H3,(H2,24,26,31)/t15-/m0/s1 |
| InChIKey | FGQKJWGPWINVGG-HNNXBMFYSA-N |
| XLogP | 1.84 |
| TPSA | 131.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.58 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|