C23H30N6O4 — CID 57462689
2-[4-(cyclopropylcarbamoylamino)phenyl]-N-(2-methoxyethyl)-6-[(3S)-3-methylmorpholin-4-yl]pyrimidine-4-carboxamide (PubChem CID 57462689) has the molecular formula C23H30N6O4 and a molecular weight of 454.53 g/mol. Its IUPAC name is 2-[4-(cyclopropylcarbamoylamino)phenyl]-N-(2-methoxyethyl)-6-[(3S)-3-methylmorpholin-4-yl]pyrimidine-4-carboxamide.
| Compound Name | 2-[4-(cyclopropylcarbamoylamino)phenyl]-N-(2-methoxyethyl)-6-[(3S)-3-methylmorpholin-4-yl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 57462689 |
| Molecular Formula | C23H30N6O4 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | 2-[4-(cyclopropylcarbamoylamino)phenyl]-N-(2-methoxyethyl)-6-[(3S)-3-methylmorpholin-4-yl]pyrimidine-4-carboxamide |
| SMILES | COCCNC(=O)c1cc(N2CCOC[C@@H]2C)nc(-c2ccc(NC(=O)NC3CC3)cc2)n1 |
| InChI | InChI=1S/C23H30N6O4/c1-15-14-33-12-10-29(15)20-13-19(22(30)24-9-11-32-2)27-21(28-20)16-3-5-17(6-4-16)25-23(31)26-18-7-8-18/h3-6,13,15,18H,7-12,14H2,1-2H3,(H,24,30)(H2,25,26,31)/t15-/m0/s1 |
| InChIKey | OWGYJDICMIPGTF-HNNXBMFYSA-N |
| XLogP | 2.03 |
| TPSA | 117.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|