C26H38N5O2S+ — CID 163432684
2-[2-[4-(cyclobutylcarbamoylamino)phenyl]-6-[(3S)-3-methylmorpholin-4-yl]pyrimidin-4-yl]propan-2-yl-propan-2-ylsulfanium (PubChem CID 163432684) has the molecular formula C26H38N5O2S+ and a molecular weight of 484.69 g/mol. Its IUPAC name is 2-[2-[4-(cyclobutylcarbamoylamino)phenyl]-6-[(3S)-3-methylmorpholin-4-yl]pyrimidin-4-yl]propan-2-yl-propan-2-ylsulfanium.
| Compound Name | 2-[2-[4-(cyclobutylcarbamoylamino)phenyl]-6-[(3S)-3-methylmorpholin-4-yl]pyrimidin-4-yl]propan-2-yl-propan-2-ylsulfanium |
|---|---|
| PubChem CID | 163432684 |
| Molecular Formula | C26H38N5O2S+ |
| Molecular Weight | 484.69 g/mol |
| Exact Mass | 484.27 |
| IUPAC Name | 2-[2-[4-(cyclobutylcarbamoylamino)phenyl]-6-[(3S)-3-methylmorpholin-4-yl]pyrimidin-4-yl]propan-2-yl-propan-2-ylsulfanium |
| SMILES | CC(C)[SH+]C(C)(C)c1cc(N2CCOC[C@@H]2C)nc(-c2ccc(NC(=O)NC3CCC3)cc2)n1 |
| InChI | InChI=1S/C26H37N5O2S/c1-17(2)34-26(4,5)22-15-23(31-13-14-33-16-18(31)3)30-24(29-22)19-9-11-21(12-10-19)28-25(32)27-20-7-6-8-20/h9-12,15,17-18,20H,6-8,13-14,16H2,1-5H3,(H2,27,28,32)/p+1/t18-/m0/s1 |
| InChIKey | ARVQJTUSABMUBF-SFHVURJKSA-O |
| XLogP | 4.50 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.69 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|