C23H32N5O3S+ — CID 163460410
2-[2-[4-[(3-hydroxyazetidine-1-carbonyl)amino]phenyl]-6-[(3S)-3-methylmorpholin-4-yl]pyrimidin-4-yl]propan-2-yl-methylsulfanium (PubChem CID 163460410) has the molecular formula C23H32N5O3S+ and a molecular weight of 458.61 g/mol. Its IUPAC name is 2-[2-[4-[(3-hydroxyazetidine-1-carbonyl)amino]phenyl]-6-[(3S)-3-methylmorpholin-4-yl]pyrimidin-4-yl]propan-2-yl-methylsulfanium.
| Compound Name | 2-[2-[4-[(3-hydroxyazetidine-1-carbonyl)amino]phenyl]-6-[(3S)-3-methylmorpholin-4-yl]pyrimidin-4-yl]propan-2-yl-methylsulfanium |
|---|---|
| PubChem CID | 163460410 |
| Molecular Formula | C23H32N5O3S+ |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | 2-[2-[4-[(3-hydroxyazetidine-1-carbonyl)amino]phenyl]-6-[(3S)-3-methylmorpholin-4-yl]pyrimidin-4-yl]propan-2-yl-methylsulfanium |
| SMILES | C[SH+]C(C)(C)c1cc(N2CCOC[C@@H]2C)nc(-c2ccc(NC(=O)N3CC(O)C3)cc2)n1 |
| InChI | InChI=1S/C23H31N5O3S/c1-15-14-31-10-9-28(15)20-11-19(23(2,3)32-4)25-21(26-20)16-5-7-17(8-6-16)24-22(30)27-12-18(29)13-27/h5-8,11,15,18,29H,9-10,12-14H2,1-4H3,(H,24,30)/p+1/t15-/m0/s1 |
| InChIKey | BOBVGOIEACSRLV-HNNXBMFYSA-O |
| XLogP | 2.26 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|