C23H34N6O3S — CID 143633375
formamide;4-[4-(methylsulfanylmethyl)-6-morpholin-4-ylpyrimidin-2-yl]-N-(2-morpholin-4-ylethyl)aniline (PubChem CID 143633375) has the molecular formula C23H34N6O3S and a molecular weight of 474.63 g/mol. Its IUPAC name is formamide;4-[4-(methylsulfanylmethyl)-6-morpholin-4-ylpyrimidin-2-yl]-N-(2-morpholin-4-ylethyl)aniline.
| Compound Name | formamide;4-[4-(methylsulfanylmethyl)-6-morpholin-4-ylpyrimidin-2-yl]-N-(2-morpholin-4-ylethyl)aniline |
|---|---|
| PubChem CID | 143633375 |
| Molecular Formula | C23H34N6O3S |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | formamide;4-[4-(methylsulfanylmethyl)-6-morpholin-4-ylpyrimidin-2-yl]-N-(2-morpholin-4-ylethyl)aniline |
| SMILES | CSCc1cc(N2CCOCC2)nc(-c2ccc(NCCN3CCOCC3)cc2)n1.NC=O |
| InChI | InChI=1S/C22H31N5O2S.CH3NO/c1-30-17-20-16-21(27-10-14-29-15-11-27)25-22(24-20)18-2-4-19(5-3-18)23-6-7-26-8-12-28-13-9-26;2-1-3/h2-5,16,23H,6-15,17H2,1H3;1H,(H2,2,3) |
| InChIKey | IALXOVYOPJFUIV-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|