C21H34N4OS — CID 143633077
ethane;4-[4-(ethylsulfanylmethyl)-6-morpholin-4-ylpyrimidin-2-yl]aniline (PubChem CID 143633077) has the molecular formula C21H34N4OS and a molecular weight of 390.60 g/mol. Its IUPAC name is ethane;4-[4-(ethylsulfanylmethyl)-6-morpholin-4-ylpyrimidin-2-yl]aniline.
| Compound Name | ethane;4-[4-(ethylsulfanylmethyl)-6-morpholin-4-ylpyrimidin-2-yl]aniline |
|---|---|
| PubChem CID | 143633077 |
| Molecular Formula | C21H34N4OS |
| Molecular Weight | 390.60 g/mol |
| Exact Mass | 390.25 |
| IUPAC Name | ethane;4-[4-(ethylsulfanylmethyl)-6-morpholin-4-ylpyrimidin-2-yl]aniline |
| SMILES | CC.CC.CCSCc1cc(N2CCOCC2)nc(-c2ccc(N)cc2)n1 |
| InChI | InChI=1S/C17H22N4OS.2C2H6/c1-2-23-12-15-11-16(21-7-9-22-10-8-21)20-17(19-15)13-3-5-14(18)6-4-13;2*1-2/h3-6,11H,2,7-10,12,18H2,1H3;2*1-2H3 |
| InChIKey | OHIXRUPJQSIRQA-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.60 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|