C25H40N4OS — CID 143633197
ethane;4-[4-(2-hexan-2-ylsulfanylpropan-2-yl)-6-morpholin-4-ylpyrimidin-2-yl]aniline (PubChem CID 143633197) has the molecular formula C25H40N4OS and a molecular weight of 444.69 g/mol. Its IUPAC name is ethane;4-[4-(2-hexan-2-ylsulfanylpropan-2-yl)-6-morpholin-4-ylpyrimidin-2-yl]aniline.
| Compound Name | ethane;4-[4-(2-hexan-2-ylsulfanylpropan-2-yl)-6-morpholin-4-ylpyrimidin-2-yl]aniline |
|---|---|
| PubChem CID | 143633197 |
| Molecular Formula | C25H40N4OS |
| Molecular Weight | 444.69 g/mol |
| Exact Mass | 444.29 |
| IUPAC Name | ethane;4-[4-(2-hexan-2-ylsulfanylpropan-2-yl)-6-morpholin-4-ylpyrimidin-2-yl]aniline |
| SMILES | CC.CCCCC(C)SC(C)(C)c1cc(N2CCOCC2)nc(-c2ccc(N)cc2)n1 |
| InChI | InChI=1S/C23H34N4OS.C2H6/c1-5-6-7-17(2)29-23(3,4)20-16-21(27-12-14-28-15-13-27)26-22(25-20)18-8-10-19(24)11-9-18;1-2/h8-11,16-17H,5-7,12-15,24H2,1-4H3;1-2H3 |
| InChIKey | YMOWBXLAZHOFPD-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.69 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|