C18H21N5O — CID 46201892
4-(7-ethyl-4-morpholin-4-ylpyrrolo[2,3-d]pyrimidin-2-yl)aniline (PubChem CID 46201892) has the molecular formula C18H21N5O and a molecular weight of 323.40 g/mol. Its IUPAC name is 4-(7-ethyl-4-morpholin-4-ylpyrrolo[2,3-d]pyrimidin-2-yl)aniline.
| Compound Name | 4-(7-ethyl-4-morpholin-4-ylpyrrolo[2,3-d]pyrimidin-2-yl)aniline |
|---|---|
| PubChem CID | 46201892 |
| Molecular Formula | C18H21N5O |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 4-(7-ethyl-4-morpholin-4-ylpyrrolo[2,3-d]pyrimidin-2-yl)aniline |
| SMILES | CCn1ccc2c(N3CCOCC3)nc(-c3ccc(N)cc3)nc21 |
| InChI | InChI=1S/C18H21N5O/c1-2-22-8-7-15-17(22)20-16(13-3-5-14(19)6-4-13)21-18(15)23-9-11-24-12-10-23/h3-8H,2,9-12,19H2,1H3 |
| InChIKey | VGTOUQWCZJJAFK-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|