C17H22N4O3 — CID 67297519
[2-(4-aminophenyl)-5-ethoxy-6-morpholin-4-ylpyrimidin-4-yl]methanol (PubChem CID 67297519) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is [2-(4-aminophenyl)-5-ethoxy-6-morpholin-4-ylpyrimidin-4-yl]methanol.
| Compound Name | [2-(4-aminophenyl)-5-ethoxy-6-morpholin-4-ylpyrimidin-4-yl]methanol |
|---|---|
| PubChem CID | 67297519 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | [2-(4-aminophenyl)-5-ethoxy-6-morpholin-4-ylpyrimidin-4-yl]methanol |
| SMILES | CCOc1c(CO)nc(-c2ccc(N)cc2)nc1N1CCOCC1 |
| InChI | InChI=1S/C17H22N4O3/c1-2-24-15-14(11-22)19-16(12-3-5-13(18)6-4-12)20-17(15)21-7-9-23-10-8-21/h3-6,22H,2,7-11,18H2,1H3 |
| InChIKey | OLKZGZOFXIACQZ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|