C18H18F3N5O — CID 46206789
4-[4-morpholin-4-yl-7-(2,2,2-trifluoroethyl)pyrrolo[2,3-d]pyrimidin-2-yl]aniline (PubChem CID 46206789) has the molecular formula C18H18F3N5O and a molecular weight of 377.37 g/mol. Its IUPAC name is 4-[4-morpholin-4-yl-7-(2,2,2-trifluoroethyl)pyrrolo[2,3-d]pyrimidin-2-yl]aniline.
| Compound Name | 4-[4-morpholin-4-yl-7-(2,2,2-trifluoroethyl)pyrrolo[2,3-d]pyrimidin-2-yl]aniline |
|---|---|
| PubChem CID | 46206789 |
| Molecular Formula | C18H18F3N5O |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 4-[4-morpholin-4-yl-7-(2,2,2-trifluoroethyl)pyrrolo[2,3-d]pyrimidin-2-yl]aniline |
| SMILES | Nc1ccc(-c2nc(N3CCOCC3)c3ccn(CC(F)(F)F)c3n2)cc1 |
| InChI | InChI=1S/C18H18F3N5O/c19-18(20,21)11-26-6-5-14-16(25-7-9-27-10-8-25)23-15(24-17(14)26)12-1-3-13(22)4-2-12/h1-6H,7-11,22H2 |
| InChIKey | JNLPXPRIPAANGC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|