C18H23N5O2 — CID 143899780
4-[4-morpholin-4-yl-6-(oxan-4-yl)-1,3,5-triazin-2-yl]aniline (PubChem CID 143899780) has the molecular formula C18H23N5O2 and a molecular weight of 341.41 g/mol. Its IUPAC name is 4-[4-morpholin-4-yl-6-(oxan-4-yl)-1,3,5-triazin-2-yl]aniline.
| Compound Name | 4-[4-morpholin-4-yl-6-(oxan-4-yl)-1,3,5-triazin-2-yl]aniline |
|---|---|
| PubChem CID | 143899780 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 4-[4-morpholin-4-yl-6-(oxan-4-yl)-1,3,5-triazin-2-yl]aniline |
| SMILES | Nc1ccc(-c2nc(C3CCOCC3)nc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C18H23N5O2/c19-15-3-1-13(2-4-15)16-20-17(14-5-9-24-10-6-14)22-18(21-16)23-7-11-25-12-8-23/h1-4,14H,5-12,19H2 |
| InChIKey | ODMNQRMDMWBVJL-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 86.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|