C21H26N6O2 — CID 145134799
4-[3-(1-methylpiperidin-4-yl)-7-morpholin-4-yl-[1,2]oxazolo[4,5-d]pyrimidin-5-yl]aniline (PubChem CID 145134799) has the molecular formula C21H26N6O2 and a molecular weight of 394.48 g/mol. Its IUPAC name is 4-[3-(1-methylpiperidin-4-yl)-7-morpholin-4-yl-[1,2]oxazolo[4,5-d]pyrimidin-5-yl]aniline.
| Compound Name | 4-[3-(1-methylpiperidin-4-yl)-7-morpholin-4-yl-[1,2]oxazolo[4,5-d]pyrimidin-5-yl]aniline |
|---|---|
| PubChem CID | 145134799 |
| Molecular Formula | C21H26N6O2 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | 4-[3-(1-methylpiperidin-4-yl)-7-morpholin-4-yl-[1,2]oxazolo[4,5-d]pyrimidin-5-yl]aniline |
| SMILES | CN1CCC(c2noc3c(N4CCOCC4)nc(-c4ccc(N)cc4)nc23)CC1 |
| InChI | InChI=1S/C21H26N6O2/c1-26-8-6-14(7-9-26)17-18-19(29-25-17)21(27-10-12-28-13-11-27)24-20(23-18)15-2-4-16(22)5-3-15/h2-5,14H,6-13,22H2,1H3 |
| InChIKey | FCCAKLFWZRNLJD-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 93.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|