C19H23N5O2 — CID 145420416
2-[2-(4-aminophenyl)-4-morpholin-4-ylpyrrolo[2,1-f][1,2,4]triazin-7-yl]propan-2-ol (PubChem CID 145420416) has the molecular formula C19H23N5O2 and a molecular weight of 353.43 g/mol. Its IUPAC name is 2-[2-(4-aminophenyl)-4-morpholin-4-ylpyrrolo[2,1-f][1,2,4]triazin-7-yl]propan-2-ol.
| Compound Name | 2-[2-(4-aminophenyl)-4-morpholin-4-ylpyrrolo[2,1-f][1,2,4]triazin-7-yl]propan-2-ol |
|---|---|
| PubChem CID | 145420416 |
| Molecular Formula | C19H23N5O2 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 2-[2-(4-aminophenyl)-4-morpholin-4-ylpyrrolo[2,1-f][1,2,4]triazin-7-yl]propan-2-ol |
| SMILES | CC(C)(O)c1ccc2c(N3CCOCC3)nc(-c3ccc(N)cc3)nn12 |
| InChI | InChI=1S/C19H23N5O2/c1-19(2,25)16-8-7-15-18(23-9-11-26-12-10-23)21-17(22-24(15)16)13-3-5-14(20)6-4-13/h3-8,25H,9-12,20H2,1-2H3 |
| InChIKey | POOQFUWIZZNCMZ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|