C20H25N5O3 — CID 126734946
[4-[4,6-bis(oxan-4-yl)-1,3,5-triazin-2-yl]phenyl]urea (PubChem CID 126734946) has the molecular formula C20H25N5O3 and a molecular weight of 383.45 g/mol. Its IUPAC name is [4-[4,6-bis(oxan-4-yl)-1,3,5-triazin-2-yl]phenyl]urea.
| Compound Name | [4-[4,6-bis(oxan-4-yl)-1,3,5-triazin-2-yl]phenyl]urea |
|---|---|
| PubChem CID | 126734946 |
| Molecular Formula | C20H25N5O3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | [4-[4,6-bis(oxan-4-yl)-1,3,5-triazin-2-yl]phenyl]urea |
| SMILES | NC(=O)Nc1ccc(-c2nc(C3CCOCC3)nc(C3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C20H25N5O3/c21-20(26)22-16-3-1-13(2-4-16)17-23-18(14-5-9-27-10-6-14)25-19(24-17)15-7-11-28-12-8-15/h1-4,14-15H,5-12H2,(H3,21,22,26) |
| InChIKey | JMAMZGIGSOTCDB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 112.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |