C20H26N6O3 — CID 67021827
4-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-6-morpholin-4-yl-1,3,5-triazin-2-yl]aniline (PubChem CID 67021827) has the molecular formula C20H26N6O3 and a molecular weight of 398.47 g/mol. Its IUPAC name is 4-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-6-morpholin-4-yl-1,3,5-triazin-2-yl]aniline.
| Compound Name | 4-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-6-morpholin-4-yl-1,3,5-triazin-2-yl]aniline |
|---|---|
| PubChem CID | 67021827 |
| Molecular Formula | C20H26N6O3 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 4-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-6-morpholin-4-yl-1,3,5-triazin-2-yl]aniline |
| SMILES | Nc1ccc(-c2nc(N3CCOCC3)nc(N3CCC4(CC3)OCCO4)n2)cc1 |
| InChI | InChI=1S/C20H26N6O3/c21-16-3-1-15(2-4-16)17-22-18(24-19(23-17)26-9-11-27-12-10-26)25-7-5-20(6-8-25)28-13-14-29-20/h1-4H,5-14,21H2 |
| InChIKey | FWEKJUIGYLMYMD-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 98.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|