C15H18N4O — CID 141367198
4-(4-ethyl-6-phenyl-1,3,5-triazin-2-yl)morpholine (PubChem CID 141367198) has the molecular formula C15H18N4O and a molecular weight of 270.34 g/mol. Its IUPAC name is 4-(4-ethyl-6-phenyl-1,3,5-triazin-2-yl)morpholine.
| Compound Name | 4-(4-ethyl-6-phenyl-1,3,5-triazin-2-yl)morpholine |
|---|---|
| PubChem CID | 141367198 |
| Molecular Formula | C15H18N4O |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 4-(4-ethyl-6-phenyl-1,3,5-triazin-2-yl)morpholine |
| SMILES | CCc1nc(-c2ccccc2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C15H18N4O/c1-2-13-16-14(12-6-4-3-5-7-12)18-15(17-13)19-8-10-20-11-9-19/h3-7H,2,8-11H2,1H3 |
| InChIKey | HKPBPUVVMIEETR-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |