C24H28N6O2 — CID 141367165
1-[4-(4-butyl-6-morpholin-4-yl-1,3,5-triazin-2-yl)phenyl]-3-phenylurea (PubChem CID 141367165) has the molecular formula C24H28N6O2 and a molecular weight of 432.53 g/mol. Its IUPAC name is 1-[4-(4-butyl-6-morpholin-4-yl-1,3,5-triazin-2-yl)phenyl]-3-phenylurea.
| Compound Name | 1-[4-(4-butyl-6-morpholin-4-yl-1,3,5-triazin-2-yl)phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 141367165 |
| Molecular Formula | C24H28N6O2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 1-[4-(4-butyl-6-morpholin-4-yl-1,3,5-triazin-2-yl)phenyl]-3-phenylurea |
| SMILES | CCCCc1nc(-c2ccc(NC(=O)Nc3ccccc3)cc2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C24H28N6O2/c1-2-3-9-21-27-22(29-23(28-21)30-14-16-32-17-15-30)18-10-12-20(13-11-18)26-24(31)25-19-7-5-4-6-8-19/h4-8,10-13H,2-3,9,14-17H2,1H3,(H2,25,26,31) |
| InChIKey | YJMWKLOAKQKMGG-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |