C22H23N7O3 — CID 87059834
1-[4-[4-morpholin-4-yl-6-(3-oxopropyl)-1,3,5-triazin-2-yl]phenyl]-3-pyridin-4-ylurea (PubChem CID 87059834) has the molecular formula C22H23N7O3 and a molecular weight of 433.47 g/mol. Its IUPAC name is 1-[4-[4-morpholin-4-yl-6-(3-oxopropyl)-1,3,5-triazin-2-yl]phenyl]-3-pyridin-4-ylurea.
| Compound Name | 1-[4-[4-morpholin-4-yl-6-(3-oxopropyl)-1,3,5-triazin-2-yl]phenyl]-3-pyridin-4-ylurea |
|---|---|
| PubChem CID | 87059834 |
| Molecular Formula | C22H23N7O3 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | 1-[4-[4-morpholin-4-yl-6-(3-oxopropyl)-1,3,5-triazin-2-yl]phenyl]-3-pyridin-4-ylurea |
| SMILES | O=CCCc1nc(-c2ccc(NC(=O)Nc3ccncc3)cc2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C22H23N7O3/c30-13-1-2-19-26-20(28-21(27-19)29-11-14-32-15-12-29)16-3-5-17(6-4-16)24-22(31)25-18-7-9-23-10-8-18/h3-10,13H,1-2,11-12,14-15H2,(H2,23,24,25,31) |
| InChIKey | YJLQZMIBBIGVOD-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 122.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|