C19H20N8O2 — CID 141367192
1-[4-(4-amino-6-morpholin-4-yl-1,3,5-triazin-2-yl)phenyl]-3-pyridin-4-ylurea (PubChem CID 141367192) has the molecular formula C19H20N8O2 and a molecular weight of 392.42 g/mol. Its IUPAC name is 1-[4-(4-amino-6-morpholin-4-yl-1,3,5-triazin-2-yl)phenyl]-3-pyridin-4-ylurea.
| Compound Name | 1-[4-(4-amino-6-morpholin-4-yl-1,3,5-triazin-2-yl)phenyl]-3-pyridin-4-ylurea |
|---|---|
| PubChem CID | 141367192 |
| Molecular Formula | C19H20N8O2 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 1-[4-(4-amino-6-morpholin-4-yl-1,3,5-triazin-2-yl)phenyl]-3-pyridin-4-ylurea |
| SMILES | Nc1nc(-c2ccc(NC(=O)Nc3ccncc3)cc2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C19H20N8O2/c20-17-24-16(25-18(26-17)27-9-11-29-12-10-27)13-1-3-14(4-2-13)22-19(28)23-15-5-7-21-8-6-15/h1-8H,9-12H2,(H2,20,24,25,26)(H2,21,22,23,28) |
| InChIKey | JYVCQMAROYFREL-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 131.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |