C23H22N8O2 — CID 66585720
1-[4-(4-morpholin-4-yl-6-pyrazol-1-yl-1,3,5-triazin-2-yl)phenyl]-3-phenylurea (PubChem CID 66585720) has the molecular formula C23H22N8O2 and a molecular weight of 442.48 g/mol. Its IUPAC name is 1-[4-(4-morpholin-4-yl-6-pyrazol-1-yl-1,3,5-triazin-2-yl)phenyl]-3-phenylurea.
| Compound Name | 1-[4-(4-morpholin-4-yl-6-pyrazol-1-yl-1,3,5-triazin-2-yl)phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 66585720 |
| Molecular Formula | C23H22N8O2 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 1-[4-(4-morpholin-4-yl-6-pyrazol-1-yl-1,3,5-triazin-2-yl)phenyl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)Nc1ccc(-c2nc(N3CCOCC3)nc(-n3cccn3)n2)cc1 |
| InChI | InChI=1S/C23H22N8O2/c32-23(25-18-5-2-1-3-6-18)26-19-9-7-17(8-10-19)20-27-21(30-13-15-33-16-14-30)29-22(28-20)31-12-4-11-24-31/h1-12H,13-16H2,(H2,25,26,32) |
| InChIKey | JYLMWVRHOPVKDO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 110.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |