C29H38N8O2 — CID 66585548
1-[4-[4-(dimethylamino)piperidin-1-yl]phenyl]-3-[4-(4-ethyl-6-morpholin-4-yl-1,3,5-triazin-2-yl)phenyl]urea (PubChem CID 66585548) has the molecular formula C29H38N8O2 and a molecular weight of 530.68 g/mol. Its IUPAC name is 1-[4-[4-(dimethylamino)piperidin-1-yl]phenyl]-3-[4-(4-ethyl-6-morpholin-4-yl-1,3,5-triazin-2-yl)phenyl]urea.
| Compound Name | 1-[4-[4-(dimethylamino)piperidin-1-yl]phenyl]-3-[4-(4-ethyl-6-morpholin-4-yl-1,3,5-triazin-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 66585548 |
| Molecular Formula | C29H38N8O2 |
| Molecular Weight | 530.68 g/mol |
| Exact Mass | 530.31 |
| IUPAC Name | 1-[4-[4-(dimethylamino)piperidin-1-yl]phenyl]-3-[4-(4-ethyl-6-morpholin-4-yl-1,3,5-triazin-2-yl)phenyl]urea |
| SMILES | CCc1nc(-c2ccc(NC(=O)Nc3ccc(N4CCC(N(C)C)CC4)cc3)cc2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C29H38N8O2/c1-4-26-32-27(34-28(33-26)37-17-19-39-20-18-37)21-5-7-22(8-6-21)30-29(38)31-23-9-11-25(12-10-23)36-15-13-24(14-16-36)35(2)3/h5-12,24H,4,13-20H2,1-3H3,(H2,30,31,38) |
| InChIKey | QGSFVRZFHNHAFE-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 98.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.68 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|