C22H29N5O3 — CID 12624037
4-(2,4-dimorpholin-4-yl-6-phenylpyrimidin-5-yl)morpholine (PubChem CID 12624037) has the molecular formula C22H29N5O3 and a molecular weight of 411.51 g/mol. Its IUPAC name is 4-(2,4-dimorpholin-4-yl-6-phenylpyrimidin-5-yl)morpholine.
| Compound Name | 4-(2,4-dimorpholin-4-yl-6-phenylpyrimidin-5-yl)morpholine |
|---|---|
| PubChem CID | 12624037 |
| Molecular Formula | C22H29N5O3 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | 4-(2,4-dimorpholin-4-yl-6-phenylpyrimidin-5-yl)morpholine |
| SMILES | c1ccc(-c2nc(N3CCOCC3)nc(N3CCOCC3)c2N2CCOCC2)cc1 |
| InChI | InChI=1S/C22H29N5O3/c1-2-4-18(5-3-1)19-20(25-6-12-28-13-7-25)21(26-8-14-29-15-9-26)24-22(23-19)27-10-16-30-17-11-27/h1-5H,6-17H2 |
| InChIKey | XWTNJUXOINNVHU-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |