C21H25N5O3 — CID 57431755
6-benzyl-2,4-dimorpholin-4-yl-5H-pyrrolo[3,4-d]pyrimidin-7-one (PubChem CID 57431755) has the molecular formula C21H25N5O3 and a molecular weight of 395.46 g/mol. Its IUPAC name is 6-benzyl-2,4-dimorpholin-4-yl-5H-pyrrolo[3,4-d]pyrimidin-7-one.
| Compound Name | 6-benzyl-2,4-dimorpholin-4-yl-5H-pyrrolo[3,4-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 57431755 |
| Molecular Formula | C21H25N5O3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 6-benzyl-2,4-dimorpholin-4-yl-5H-pyrrolo[3,4-d]pyrimidin-7-one |
| SMILES | O=C1c2nc(N3CCOCC3)nc(N3CCOCC3)c2CN1Cc1ccccc1 |
| InChI | InChI=1S/C21H25N5O3/c27-20-18-17(15-26(20)14-16-4-2-1-3-5-16)19(24-6-10-28-11-7-24)23-21(22-18)25-8-12-29-13-9-25/h1-5H,6-15H2 |
| InChIKey | OLCOZECKMWCLNV-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 71.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |