C13H17N5O — CID 15050995
2-benzyl-5-morpholin-4-yl-1,2,4-triazol-3-amine (PubChem CID 15050995) has the molecular formula C13H17N5O and a molecular weight of 259.31 g/mol. Its IUPAC name is 2-benzyl-5-morpholin-4-yl-1,2,4-triazol-3-amine.
| Compound Name | 2-benzyl-5-morpholin-4-yl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 15050995 |
| Molecular Formula | C13H17N5O |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 2-benzyl-5-morpholin-4-yl-1,2,4-triazol-3-amine |
| SMILES | Nc1nc(N2CCOCC2)nn1Cc1ccccc1 |
| InChI | InChI=1S/C13H17N5O/c14-12-15-13(17-6-8-19-9-7-17)16-18(12)10-11-4-2-1-3-5-11/h1-5H,6-10H2,(H2,14,15,16) |
| InChIKey | INXODOBOTCQRNL-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |