C8H15N7OS — CID 19752262
2-(5-amino-3-morpholin-4-yl-1,2,4-triazol-1-yl)ethanethiohydrazide (PubChem CID 19752262) has the molecular formula C8H15N7OS and a molecular weight of 257.32 g/mol. Its IUPAC name is 2-(5-amino-3-morpholin-4-yl-1,2,4-triazol-1-yl)ethanethiohydrazide.
| Compound Name | 2-(5-amino-3-morpholin-4-yl-1,2,4-triazol-1-yl)ethanethiohydrazide |
|---|---|
| PubChem CID | 19752262 |
| Molecular Formula | C8H15N7OS |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 2-(5-amino-3-morpholin-4-yl-1,2,4-triazol-1-yl)ethanethiohydrazide |
| SMILES | NNC(=S)Cn1nc(N2CCOCC2)nc1N |
| InChI | InChI=1S/C8H15N7OS/c9-7-11-8(14-1-3-16-4-2-14)13-15(7)5-6(17)12-10/h1-5,10H2,(H,12,17)(H2,9,11,13) |
| InChIKey | WUISBUBMTUCRBO-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 107.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|