C10H18N6O2S — CID 19106565
2-(5-amino-3-morpholin-4-yl-1,2,4-triazol-1-yl)-3-methoxypropanethioamide (PubChem CID 19106565) has the molecular formula C10H18N6O2S and a molecular weight of 286.36 g/mol. Its IUPAC name is 2-(5-amino-3-morpholin-4-yl-1,2,4-triazol-1-yl)-3-methoxypropanethioamide.
| Compound Name | 2-(5-amino-3-morpholin-4-yl-1,2,4-triazol-1-yl)-3-methoxypropanethioamide |
|---|---|
| PubChem CID | 19106565 |
| Molecular Formula | C10H18N6O2S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 2-(5-amino-3-morpholin-4-yl-1,2,4-triazol-1-yl)-3-methoxypropanethioamide |
| SMILES | COCC(C(N)=S)n1nc(N2CCOCC2)nc1N |
| InChI | InChI=1S/C10H18N6O2S/c1-17-6-7(8(11)19)16-9(12)13-10(14-16)15-2-4-18-5-3-15/h7H,2-6H2,1H3,(H2,11,19)(H2,12,13,14) |
| InChIKey | UXVOXOABAPUGCR-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|