C17H22N8O2 — CID 44600625
5-[9-(1-methoxypropan-2-yl)-2-morpholin-4-ylpurin-6-yl]pyrazin-2-amine (PubChem CID 44600625) has the molecular formula C17H22N8O2 and a molecular weight of 370.42 g/mol. Its IUPAC name is 5-[9-(1-methoxypropan-2-yl)-2-morpholin-4-ylpurin-6-yl]pyrazin-2-amine.
| Compound Name | 5-[9-(1-methoxypropan-2-yl)-2-morpholin-4-ylpurin-6-yl]pyrazin-2-amine |
|---|---|
| PubChem CID | 44600625 |
| Molecular Formula | C17H22N8O2 |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 5-[9-(1-methoxypropan-2-yl)-2-morpholin-4-ylpurin-6-yl]pyrazin-2-amine |
| SMILES | COCC(C)n1cnc2c(-c3cnc(N)cn3)nc(N3CCOCC3)nc21 |
| InChI | InChI=1S/C17H22N8O2/c1-11(9-26-2)25-10-21-15-14(12-7-20-13(18)8-19-12)22-17(23-16(15)25)24-3-5-27-6-4-24/h7-8,10-11H,3-6,9H2,1-2H3,(H2,18,20) |
| InChIKey | WWDQUUDKMQZEOL-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 117.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |