C27H33Cl2N11O — CID 158100431
9-butan-2-yl-2,6-dichloropurine;5-(9-butan-2-yl-2-morpholin-4-ylpurin-6-yl)pyridin-2-amine (PubChem CID 158100431) has the molecular formula C27H33Cl2N11O and a molecular weight of 598.54 g/mol. Its IUPAC name is 9-butan-2-yl-2,6-dichloropurine;5-(9-butan-2-yl-2-morpholin-4-ylpurin-6-yl)pyridin-2-amine.
| Compound Name | 9-butan-2-yl-2,6-dichloropurine;5-(9-butan-2-yl-2-morpholin-4-ylpurin-6-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 158100431 |
| Molecular Formula | C27H33Cl2N11O |
| Molecular Weight | 598.54 g/mol |
| Exact Mass | 597.22 |
| IUPAC Name | 9-butan-2-yl-2,6-dichloropurine;5-(9-butan-2-yl-2-morpholin-4-ylpurin-6-yl)pyridin-2-amine |
| SMILES | CCC(C)n1cnc2c(-c3ccc(N)nc3)nc(N3CCOCC3)nc21.CCC(C)n1cnc2c(Cl)nc(Cl)nc21 |
| InChI | InChI=1S/C18H23N7O.C9H10Cl2N4/c1-3-12(2)25-11-21-16-15(13-4-5-14(19)20-10-13)22-18(23-17(16)25)24-6-8-26-9-7-24;1-3-5(2)15-4-12-6-7(10)13-9(11)14-8(6)15/h4-5,10-12H,3,6-9H2,1-2H3,(H2,19,20);4-5H,3H2,1-2H3 |
| InChIKey | FPEPCMZJVZFLDX-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 138.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.54 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |